CAS 323592-87-6 is the registry number for (6R)-6-(HYDROXYMETHYL)-4-(PHENYLMETHYL)-2-PIPERAZINONE, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(6R)-4-benzyl-6-(hydroxymethyl)piperazin-2-one (CAS 323592-87-6) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: (6R)-4-benzyl-6-(hydroxymethyl)piperazin-2-one. InChIKey: PPDBHJIKWGZCBH-LLVKDONJSA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | (6R)-4-benzyl-6-(hydroxymethyl)piperazin-2-one |
| InChIKey | PPDBHJIKWGZCBH-LLVKDONJSA-N |
| SMILES | C1[C@@H](NC(=O)CN1CC2=CC=CC=C2)CO |
Computed by PubChem (NCBI)