Products 32385-30-1

CAS 32385-30-1 is the registry number for 3-(2-Naphthylsulfonyl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

3-naphthalen-2-ylsulfonylpropanoic acid (CAS 32385-30-1) is a chemical compound with the molecular formula C13H12O4S and a molecular weight of 264.30 g/mol. IUPAC name: 3-naphthalen-2-ylsulfonylpropanoic acid. InChIKey: OSYQPWIOAFNQLP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12O4S
Molecular weight264.30 g/mol
IUPAC name3-naphthalen-2-ylsulfonylpropanoic acid
InChIKeyOSYQPWIOAFNQLP-UHFFFAOYSA-N
SMILESC1=CC=C2C=C(C=CC2=C1)S(=O)(=O)CCC(=O)O

Computed by PubChem (NCBI)