Products 934080-88-3

CAS 934080-88-3 is the registry number for 5-(2-Methoxyphenoxymethyl)thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

5-[(2-methoxyphenoxy)methyl]thiophene-2-carboxylic acid (CAS 934080-88-3) is a chemical compound with the molecular formula C13H12O4S and a molecular weight of 264.30 g/mol. IUPAC name: 5-[(2-methoxyphenoxy)methyl]thiophene-2-carboxylic acid. InChIKey: SFZNBJPBZIMGQE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12O4S
Molecular weight264.30 g/mol
IUPAC name5-[(2-methoxyphenoxy)methyl]thiophene-2-carboxylic acid
InChIKeySFZNBJPBZIMGQE-UHFFFAOYSA-N
SMILESCOC1=CC=CC=C1OCC2=CC=C(S2)C(=O)O

Computed by PubChem (NCBI)