CAS 32386-49-5 appears in our catalog under these names: 3-Benzylpentanedioic acid, 95+%, 3-Benzylpentanedioic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-benzylpentanedioic acid (CAS 32386-49-5) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 3-benzylpentanedioic acid. InChIKey: QHKFYKDZHMELQR-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3-benzylpentanedioic acid |
| InChIKey | QHKFYKDZHMELQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)