CAS 324055-38-1 is the registry number for 2-(1-(3-Aminophenyl)ethylidene)-N-(p-tolyl)hydrazine-1-carbothioamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(E)-1-(3-aminophenyl)ethylideneamino]-3-(4-methylphenyl)thiourea (CAS 324055-38-1) is a chemical compound with the molecular formula C16H18N4S and a molecular weight of 298.4 g/mol. IUPAC name: 1-[(E)-1-(3-aminophenyl)ethylideneamino]-3-(4-methylphenyl)thiourea. InChIKey: WDZBHAJXLZOEPE-XDHOZWIPSA-N.
| Molecular formula | C16H18N4S |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 1-[(E)-1-(3-aminophenyl)ethylideneamino]-3-(4-methylphenyl)thiourea |
| InChIKey | WDZBHAJXLZOEPE-XDHOZWIPSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=S)N/N=C(\C)/C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)