Products 786686-82-6
CAS 786686-82-6 appears in our catalog under these names: N-Desmethyl Olanzapine-d8, N-Demethyl Olanzapine-d8, N-Desmethylolanzapine-d8. Offered by: Chemat Brand, TRC, TargetMol, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 1 mg.
2-methyl-4-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepine (CAS 786686-82-6) is a chemical compound with the molecular formula C16H18N4S and a molecular weight of 306.5 g/mol. IUPAC name: 2-methyl-4-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepine. InChIKey: FHPIXVHJEIZKJW-COMRDEPKSA-N.
| Molecular formula | C16H18N4S |
|---|---|
| Molecular weight | 306.5 g/mol |
| IUPAC name | 2-methyl-4-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepine |
| InChIKey | FHPIXVHJEIZKJW-COMRDEPKSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C2=NC3=CC=CC=C3NC4=C2C=C(S4)C)([2H])[2H])[2H] |
Computed by PubChem (NCBI)