Products 324776-41-2
CAS 324776-41-2 is the registry number for 1-[(4-chlorophenyl)sulfonyl]-4-methylpiperazine, 95%. Offered by: Chemat. Available pack sizes: 100mg.
1-(4-chlorophenyl)sulfonyl-4-methylpiperazine (CAS 324776-41-2) is a chemical compound with the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. IUPAC name: 1-(4-chlorophenyl)sulfonyl-4-methylpiperazine. InChIKey: CJDFBUZPJNPXSC-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2S |
|---|---|
| Molecular weight | 274.77 g/mol |
| IUPAC name | 1-(4-chlorophenyl)sulfonyl-4-methylpiperazine |
| InChIKey | CJDFBUZPJNPXSC-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)