CAS 32508-98-8 appears in our catalog under these names: 2-Hydroxyethyl 2-((3-(trifluoromethyl)phenyl)amino)benzoate, 95+%, Etofenamate EP Impurity G, 2-((3-(Trifluoromethyl)phenyl)amino)benzoic Acid 2-Hydroxyethyl Ester, 2-((3-(Trifluoromethyl)phenyl)amino) benzoic acid 2-hydroxyethyl ester, ETOFENAMATE IMPURITY G. Offered by: AmBeed, Mikromol, TRC, Biosynth, Sigma-Aldrich. Available pack sizes: 1g, 25mg, 100mg, 2000mg, 1000mg, 5000mg, 10000mg, 1EA.
2-hydroxyethyl 2-[3-(trifluoromethyl)anilino]benzoate (CAS 32508-98-8) is a chemical compound with the molecular formula C16H14F3NO3 and a molecular weight of 325.28 g/mol. IUPAC name: 2-hydroxyethyl 2-[3-(trifluoromethyl)anilino]benzoate. InChIKey: QTAIVYIVAODSBA-UHFFFAOYSA-N.
| Molecular formula | C16H14F3NO3 |
|---|---|
| Molecular weight | 325.28 g/mol |
| IUPAC name | 2-hydroxyethyl 2-[3-(trifluoromethyl)anilino]benzoate |
| InChIKey | QTAIVYIVAODSBA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)OCCO)NC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)