CAS 927685-43-6 appears in our catalog under these names: Aad-2004, 95%, Crisdesalazine/ 95.95% (existing batch purity), Crisdesalazine, 2-Hydroxy-5-((4-(trifluoromethyl)phenethyl)amino)benzoic acid, 95%, 95%, Crisdesalazine, 98.92%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
2-hydroxy-5-[2-[4-(trifluoromethyl)phenyl]ethylamino]benzoic acid (CAS 927685-43-6) is a chemical compound with the molecular formula C16H14F3NO3 and a molecular weight of 325.28 g/mol. IUPAC name: 2-hydroxy-5-[2-[4-(trifluoromethyl)phenyl]ethylamino]benzoic acid. InChIKey: UTMVACIBQLDZLP-UHFFFAOYSA-N.
| Molecular formula | C16H14F3NO3 |
|---|---|
| Molecular weight | 325.28 g/mol |
| IUPAC name | 2-hydroxy-5-[2-[4-(trifluoromethyl)phenyl]ethylamino]benzoic acid |
| InChIKey | UTMVACIBQLDZLP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCNC2=CC(=C(C=C2)O)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)