Products 32510-93-3
CAS 32510-93-3 appears in our catalog under these names: Cyclo(L–Leu–D–Pro), Cyclo(L-Leu-D-Pro), 98.21%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10 mg, 5 mg.
(3S,8aR)-3-(2-methylpropyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (CAS 32510-93-3) is a chemical compound with the molecular formula C11H18N2O2 and a molecular weight of 210.27 g/mol. IUPAC name: (3S,8aR)-3-(2-methylpropyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione. InChIKey: SZJNCZMRZAUNQT-DTWKUNHWSA-N.
| Molecular formula | C11H18N2O2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | (3S,8aR)-3-(2-methylpropyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| InChIKey | SZJNCZMRZAUNQT-DTWKUNHWSA-N |
| SMILES | CC(C)C[C@H]1C(=O)N2CCC[C@@H]2C(=O)N1 |
Computed by PubChem (NCBI)