Products 32512-42-8
CAS 32512-42-8 appears in our catalog under these names: Benzyl (2-phenyloxazol-4-yl)carbamate, 98%, 98%, Benzyl (2-phenyloxazol-4-yl)carbamate. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Benzyl N-(2-phenyl-1,3-oxazol-4-yl)carbamate (CAS 32512-42-8) is a chemical compound with the molecular formula C17H14N2O3 and a molecular weight of 294.30 g/mol. IUPAC name: benzyl N-(2-phenyl-1,3-oxazol-4-yl)carbamate. InChIKey: BXOPKFCIABODBD-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O3 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | benzyl N-(2-phenyl-1,3-oxazol-4-yl)carbamate |
| InChIKey | BXOPKFCIABODBD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=COC(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)