CAS 325148-85-4 is the registry number for (2S,5S)-2,5-Dimethylpiperazine dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
(2S,5S)-2,5-dimethylpiperazine;dihydrochloride (CAS 325148-85-4) is a chemical compound with the molecular formula C6H16Cl2N2 and a molecular weight of 187.11 g/mol. IUPAC name: (2S,5S)-2,5-dimethylpiperazine;dihydrochloride. InChIKey: GOTVEDVYURXGPS-USPAICOZSA-N.
| Molecular formula | C6H16Cl2N2 |
|---|---|
| Molecular weight | 187.11 g/mol |
| IUPAC name | (2S,5S)-2,5-dimethylpiperazine;dihydrochloride |
| InChIKey | GOTVEDVYURXGPS-USPAICOZSA-N |
| SMILES | C[C@H]1CN[C@H](CN1)C.Cl.Cl |
Computed by PubChem (NCBI)