CAS 32543-51-4 is the registry number for (1S,4S,6R)-1-Methyl-4-(prop-1-en-2-yl)-7-oxabicyclo(4.1.0)heptane, 98%. Offered by: AmBeed. Available pack sizes: 100mg.
(1S,4S,6R)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptane (CAS 32543-51-4) is a chemical compound with the molecular formula C10H16O and a molecular weight of 152.23 g/mol. IUPAC name: (1S,4S,6R)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptane. InChIKey: CCEFMUBVSUDRLG-AEJSXWLSSA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | (1S,4S,6R)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptane |
| InChIKey | CCEFMUBVSUDRLG-AEJSXWLSSA-N |
| SMILES | CC(=C)[C@H]1CC[C@]2([C@@H](C1)O2)C |
Computed by PubChem (NCBI)