CAS 4959-35-7 is the registry number for rel-(1R,4S,6S)-1-Methyl-4-(prop-1-en-2-yl)-7-oxabicyclo[4.1.0]heptane, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,4S,6S)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptane (CAS 4959-35-7) is a chemical compound with the molecular formula C10H16O and a molecular weight of 152.23 g/mol. IUPAC name: (1R,4S,6S)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptane. InChIKey: CCEFMUBVSUDRLG-LPEHRKFASA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | (1R,4S,6S)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptane |
| InChIKey | CCEFMUBVSUDRLG-LPEHRKFASA-N |
| SMILES | CC(=C)[C@H]1CC[C@@]2([C@H](C1)O2)C |
Computed by PubChem (NCBI)