Products 325775-42-6
CAS 325775-42-6 appears in our catalog under these names: Cathepsin K inhibitor 6, Cathepsin K inhibitor 6, 98.18%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 5 mg, 50 mg, 25 mg, 10 mg.
N-[(1-cyanoazetidin-3-yl)methyl]benzenesulfonamide (CAS 325775-42-6) is a chemical compound with the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. IUPAC name: N-[(1-cyanoazetidin-3-yl)methyl]benzenesulfonamide. InChIKey: UIOWYXXRERXCMP-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2S |
|---|---|
| Molecular weight | 251.31 g/mol |
| IUPAC name | N-[(1-cyanoazetidin-3-yl)methyl]benzenesulfonamide |
| InChIKey | UIOWYXXRERXCMP-UHFFFAOYSA-N |
| SMILES | C1C(CN1C#N)CNS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)