Products 32578-11-3
CAS 32578-11-3 appears in our catalog under these names: 1-(3-Methoxyphenyl)-2,2-dimethylpropan-1-ol, 95%, 1-(3-Methoxyphenyl)-2,2-dimethylpropan-1-ol, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-methoxyphenyl)-2,2-dimethylpropan-1-ol (CAS 32578-11-3) is a chemical compound with the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. IUPAC name: 1-(3-methoxyphenyl)-2,2-dimethylpropan-1-ol. InChIKey: SWXBWSDLBPOHFE-UHFFFAOYSA-N.
| Molecular formula | C12H18O2 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)-2,2-dimethylpropan-1-ol |
| InChIKey | SWXBWSDLBPOHFE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CC(=CC=C1)OC)O |
Computed by PubChem (NCBI)