Products 325850-98-4

CAS 325850-98-4 is the registry number for 4-​(((Tetrahydro-​1,​1-​dioxido-​3-​thienyl)​amino)​sulfonyl)​-benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.

Structural formula: {0} (CAS {1})

4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoic acid (CAS 325850-98-4) is a chemical compound with the molecular formula C11H13NO6S2 and a molecular weight of 319.4 g/mol. IUPAC name: 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoic acid. InChIKey: PANIHRKSOILEGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO6S2
Molecular weight319.4 g/mol
IUPAC name4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoic acid
InChIKeyPANIHRKSOILEGJ-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC1NS(=O)(=O)C2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)