CAS 325850-98-4 is the registry number for 4-​(((Tetrahydro-​1,​1-​dioxido-​3-​thienyl)​amino)​sulfonyl)​-benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoic acid (CAS 325850-98-4) is a chemical compound with the molecular formula C11H13NO6S2 and a molecular weight of 319.4 g/mol. IUPAC name: 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoic acid. InChIKey: PANIHRKSOILEGJ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO6S2 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoic acid |
| InChIKey | PANIHRKSOILEGJ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1NS(=O)(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)