CAS 923697-25-0 appears in our catalog under these names: 3-([(1,1-Dioxidotetrahydrothien-3-yl)amino]sulfonyl)benzoic acid, 95%, 3-(N-(1,1-Dioxidotetrahydrothiophen-3-yl)sulfamoyl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoic acid (CAS 923697-25-0) is a chemical compound with the molecular formula C11H13NO6S2 and a molecular weight of 319.4 g/mol. IUPAC name: 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoic acid. InChIKey: NDDABTAVUZYSSP-UHFFFAOYSA-N.
| Molecular formula | C11H13NO6S2 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 3-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoic acid |
| InChIKey | NDDABTAVUZYSSP-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1NS(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)