Products 325855-71-8

CAS 325855-71-8 appears in our catalog under these names: Etoricoxib Impurity 41, Etoricoxib Impurity 24, Etoricoxib N-Oxide 2. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-chloro-2-(6-methyl-3-pyridinyl)-3-(4-methylsulfonylphenyl)-1-oxidopyridin-1-ium (CAS 325855-71-8) is a chemical compound with the molecular formula C18H15ClN2O3S and a molecular weight of 374.8 g/mol. IUPAC name: 5-chloro-2-(6-methyl-3-pyridinyl)-3-(4-methylsulfonylphenyl)-1-oxidopyridin-1-ium. InChIKey: WUCQKIZLSIXPRA-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15ClN2O3S
Molecular weight374.8 g/mol
IUPAC name5-chloro-2-(6-methyl-3-pyridinyl)-3-(4-methylsulfonylphenyl)-1-oxidopyridin-1-ium
InChIKeyWUCQKIZLSIXPRA-UHFFFAOYSA-N
SMILESCC1=NC=C(C=C1)C2=C(C=C(C=[N+]2[O-])Cl)C3=CC=C(C=C3)S(=O)(=O)C

Computed by PubChem (NCBI)