CAS 325855-71-8 appears in our catalog under these names: Etoricoxib Impurity 41, Etoricoxib Impurity 24, Etoricoxib N-Oxide 2. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-2-(6-methyl-3-pyridinyl)-3-(4-methylsulfonylphenyl)-1-oxidopyridin-1-ium (CAS 325855-71-8) is a chemical compound with the molecular formula C18H15ClN2O3S and a molecular weight of 374.8 g/mol. IUPAC name: 5-chloro-2-(6-methyl-3-pyridinyl)-3-(4-methylsulfonylphenyl)-1-oxidopyridin-1-ium. InChIKey: WUCQKIZLSIXPRA-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN2O3S |
|---|---|
| Molecular weight | 374.8 g/mol |
| IUPAC name | 5-chloro-2-(6-methyl-3-pyridinyl)-3-(4-methylsulfonylphenyl)-1-oxidopyridin-1-ium |
| InChIKey | WUCQKIZLSIXPRA-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)C2=C(C=C(C=[N+]2[O-])Cl)C3=CC=C(C=C3)S(=O)(=O)C |
Computed by PubChem (NCBI)