CAS 325855-74-1 appears in our catalog under these names: Etoricoxib N-Oxide 1, 5-Chloro-6'-methyl-3-(4-(methylsulfonyl)phenyl)-[2,3'-bipyridine] 1'-oxide, 95%, Etoricoxib N-Oxide, Etoricoxib N1’-Oxide, >95% (HPLC), Etoricoxib N1'-oxide. Offered by: Chemat Brand, Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio. Available pack sizes: on request, 100mg, 10mg, 50mg, 25mg, 10 mg, 25 mg, 50 mg.
5-chloro-2-(6-methyl-1-oxidopyridin-1-ium-3-yl)-3-(4-methylsulfonylphenyl)pyridine (CAS 325855-74-1) is a chemical compound with the molecular formula C18H15ClN2O3S and a molecular weight of 374.8 g/mol. IUPAC name: 5-chloro-2-(6-methyl-1-oxidopyridin-1-ium-3-yl)-3-(4-methylsulfonylphenyl)pyridine. InChIKey: KMLFAHIIJSUUPX-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN2O3S |
|---|---|
| Molecular weight | 374.8 g/mol |
| IUPAC name | 5-chloro-2-(6-methyl-1-oxidopyridin-1-ium-3-yl)-3-(4-methylsulfonylphenyl)pyridine |
| InChIKey | KMLFAHIIJSUUPX-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C=C(C=C1)C2=C(C=C(C=N2)Cl)C3=CC=C(C=C3)S(=O)(=O)C)[O-] |
Computed by PubChem (NCBI)