CAS 32597-37-8 appears in our catalog under these names: N-(3-Chloro-phenyl)-2,2-dimethyl-propionamide, 95%, N-(3-Chlorophenyl)pivalamide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
N-(3-chlorophenyl)-2,2-dimethylpropanamide (CAS 32597-37-8) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: N-(3-chlorophenyl)-2,2-dimethylpropanamide. InChIKey: OGOQXGKPTWSHPS-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | N-(3-chlorophenyl)-2,2-dimethylpropanamide |
| InChIKey | OGOQXGKPTWSHPS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)