CAS 326-66-9 appears in our catalog under these names: N-(4-Bromo-2-fluorophenyl)acetamide 98%, N-(4-Bromo-2-fluorophenyl)acetamide, 98%, 98%, 4'-Bromo-2'-fluoroacetanilide, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 500g.
N-(4-bromo-2-fluorophenyl)acetamide (CAS 326-66-9) is a chemical compound with the molecular formula C8H7BrFNO and a molecular weight of 232.05 g/mol. IUPAC name: N-(4-bromo-2-fluorophenyl)acetamide. InChIKey: BCYGKMDWQBWUSC-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFNO |
|---|---|
| Molecular weight | 232.05 g/mol |
| IUPAC name | N-(4-bromo-2-fluorophenyl)acetamide |
| InChIKey | BCYGKMDWQBWUSC-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)