CAS 32619-23-1 appears in our catalog under these names: (5S,5’S)-Dihydroxy Lysinonorleucine, >95% (HPLC), Dihydroxylysinonorleucine. Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 1 mg, 500 μg.
2-amino-6-[[(2R,5S)-5-amino-5-carboxy-2-hydroxypentyl]amino]-5-hydroxyhexanoic acid (CAS 32619-23-1) is a chemical compound with the molecular formula C12H25N3O6 and a molecular weight of 307.34 g/mol. IUPAC name: 2-amino-6-[[(2R,5S)-5-amino-5-carboxy-2-hydroxypentyl]amino]-5-hydroxyhexanoic acid. InChIKey: COYAOJMPFAKKAM-RJQCTPFPSA-N.
| Molecular formula | C12H25N3O6 |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | 2-amino-6-[[(2R,5S)-5-amino-5-carboxy-2-hydroxypentyl]amino]-5-hydroxyhexanoic acid |
| InChIKey | COYAOJMPFAKKAM-RJQCTPFPSA-N |
| SMILES | C(C[C@@H](C(=O)O)N)[C@H](CNCC(CCC(C(=O)O)N)O)O |
Computed by PubChem (NCBI)