Products 869111-52-4
CAS 869111-52-4 is the registry number for (5R,5’R)-Dihydroxy Lysinonorleucine. Offered by: TRC. Available pack sizes: 10mg, 1mg.
(2S,5R)-2-amino-6-[[(2R,5S)-5-amino-5-carboxy-2-hydroxypentyl]amino]-5-hydroxyhexanoic acid (CAS 869111-52-4) is a chemical compound with the molecular formula C12H25N3O6 and a molecular weight of 307.34 g/mol. IUPAC name: (2S,5R)-2-amino-6-[[(2R,5S)-5-amino-5-carboxy-2-hydroxypentyl]amino]-5-hydroxyhexanoic acid. InChIKey: COYAOJMPFAKKAM-IMSYWVGJSA-N.
| Molecular formula | C12H25N3O6 |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | (2S,5R)-2-amino-6-[[(2R,5S)-5-amino-5-carboxy-2-hydroxypentyl]amino]-5-hydroxyhexanoic acid |
| InChIKey | COYAOJMPFAKKAM-IMSYWVGJSA-N |
| SMILES | C(C[C@@H](C(=O)O)N)[C@H](CNC[C@@H](CC[C@@H](C(=O)O)N)O)O |
Computed by PubChem (NCBI)