CAS 3265-29-0 appears in our catalog under these names: 3-Diazooxindole, 95%, 95%, 3-(diazyn-1-ium-1-yl)-2-oxo-2,3-dihydro-1H-indol-3-ide, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-diazonio-1H-indol-2-olate (CAS 3265-29-0) is a chemical compound with the molecular formula C8H5N3O and a molecular weight of 159.14 g/mol. IUPAC name: 3-diazonio-1H-indol-2-olate. InChIKey: JUWOBCNAWKDBSM-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O |
|---|---|
| Molecular weight | 159.14 g/mol |
| IUPAC name | 3-diazonio-1H-indol-2-olate |
| InChIKey | JUWOBCNAWKDBSM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)[O-])[N+]#N |
Computed by PubChem (NCBI)