CAS 327092-62-6 appears in our catalog under these names: 3,4-Diamino-N-butylbenzene-1-sulfonamide, 95%, 3,4-Diamino-N-butylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3,4-diamino-N-butylbenzenesulfonamide (CAS 327092-62-6) is a chemical compound with the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. IUPAC name: 3,4-diamino-N-butylbenzenesulfonamide. InChIKey: UVPJLHTZTRJVBV-UHFFFAOYSA-N.
| Molecular formula | C10H17N3O2S |
|---|---|
| Molecular weight | 243.33 g/mol |
| IUPAC name | 3,4-diamino-N-butylbenzenesulfonamide |
| InChIKey | UVPJLHTZTRJVBV-UHFFFAOYSA-N |
| SMILES | CCCCNS(=O)(=O)C1=CC(=C(C=C1)N)N |
Computed by PubChem (NCBI)