CAS 327615-31-6 is the registry number for 5-Methoxy-4,7-dimethyl-2,3-dihydro-1H-indol-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-methoxy-4,7-dimethyl-1,3-dihydroindol-2-one (CAS 327615-31-6) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 5-methoxy-4,7-dimethyl-1,3-dihydroindol-2-one. InChIKey: BXEUBZUSVSUCDT-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 5-methoxy-4,7-dimethyl-1,3-dihydroindol-2-one |
| InChIKey | BXEUBZUSVSUCDT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=C1NC(=O)C2)C)OC |
Computed by PubChem (NCBI)