CAS 32765-81-4 appears in our catalog under these names: 1-Bromo-6-(trimethylammonium)hexyl bromide, 95%, 1-Bromo-6-(trimethylammonium)hexyl Bromide, >95% (HPLC), 1–Bromo–6–(trimethylammonium)hexyl bromide, 1-Bromo-6-(trimethylammonium)hexyl bromide, 6-Bromo-N,N,N-trimethylhexan-1-aminium bromide 95%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg, 2g, 10g, 25g, 100g.
6-bromohexyl(trimethyl)azanium bromide (CAS 32765-81-4) is a chemical compound with the molecular formula C9H21Br2N and a molecular weight of 303.08 g/mol. IUPAC name: 6-bromohexyl(trimethyl)azanium bromide. InChIKey: KNKBZYUINRTEOG-UHFFFAOYSA-M.
| Molecular formula | C9H21Br2N |
|---|---|
| Molecular weight | 303.08 g/mol |
| IUPAC name | 6-bromohexyl(trimethyl)azanium bromide |
| InChIKey | KNKBZYUINRTEOG-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCCCCCBr.[Br-] |
Computed by PubChem (NCBI)