CAS 3720-84-1 is the registry number for (3-Bromopropyl)triethylammoniumbromide, 98%. Offered by: AmBeed. Available pack sizes: 5g.
3-bromopropyl(triethyl)azanium bromide (CAS 3720-84-1) is a chemical compound with the molecular formula C9H21Br2N and a molecular weight of 303.08 g/mol. IUPAC name: 3-bromopropyl(triethyl)azanium bromide. InChIKey: FNKGNRUAIHVWNL-UHFFFAOYSA-M.
| Molecular formula | C9H21Br2N |
|---|---|
| Molecular weight | 303.08 g/mol |
| IUPAC name | 3-bromopropyl(triethyl)azanium bromide |
| InChIKey | FNKGNRUAIHVWNL-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CCCBr.[Br-] |
Computed by PubChem (NCBI)