CAS 3278-82-8 appears in our catalog under these names: 1,5-Dibromoanthracene, 95%, 1,5-Dibromoanthracene, >95% (HPLC), 1,5-Dibromoanthracene, 98%, 1,5–Dibromoanthracene, 1,5-Dibromoanthracene. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 10mg, 50mg, 500mg, 1000mg.
1,5-dibromoanthracene (CAS 3278-82-8) is a chemical compound with the molecular formula C14H8Br2 and a molecular weight of 336.02 g/mol. IUPAC name: 1,5-dibromoanthracene. InChIKey: DIMYVOCPPKNNPF-UHFFFAOYSA-N.
| Molecular formula | C14H8Br2 |
|---|---|
| Molecular weight | 336.02 g/mol |
| IUPAC name | 1,5-dibromoanthracene |
| InChIKey | DIMYVOCPPKNNPF-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC3=C(C=CC=C3Br)C=C2C(=C1)Br |
Computed by PubChem (NCBI)