CAS 523-27-3 appears in our catalog under these names: 9,10-Dibromoanthracene, 9,10–Dibromoanthracene, 9,10-Dibromoanthracene, 98% , 9,10-Dibromoanthracene, >98.0%(GC), 9,10-Dibromoanthracene, 96%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 50g, 5g, 100g, 500g, 25g, 10g, 1000g, 1x1000mg.
9,10-dibromoanthracene (CAS 523-27-3) is a chemical compound with the molecular formula C14H8Br2 and a molecular weight of 336.02 g/mol. IUPAC name: 9,10-dibromoanthracene. InChIKey: BRUOAURMAFDGLP-UHFFFAOYSA-N.
| Molecular formula | C14H8Br2 |
|---|---|
| Molecular weight | 336.02 g/mol |
| IUPAC name | 9,10-dibromoanthracene |
| InChIKey | BRUOAURMAFDGLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2Br)Br |
Computed by PubChem (NCBI)