CAS 32795-84-9 appears in our catalog under these names: 7-Bromobenz[a]anthracene, 95%, 7-Bromobenz(a)anthracene, >95% (HPLC), 7–Bromobenz(a)anthracene, 7-Bromobenz[a]anthracene, >98.0%(GC), 7-Bromotetraphene 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg, 10mg, 50mg, 10g.
7-bromobenzo[a]anthracene (CAS 32795-84-9) is a chemical compound with the molecular formula C18H11Br and a molecular weight of 307.2 g/mol. IUPAC name: 7-bromobenzo[a]anthracene. InChIKey: LGRNWCDRODWMOH-UHFFFAOYSA-N.
| Molecular formula | C18H11Br |
|---|---|
| Molecular weight | 307.2 g/mol |
| IUPAC name | 7-bromobenzo[a]anthracene |
| InChIKey | LGRNWCDRODWMOH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C(C4=CC=CC=C4C=C32)Br |
Computed by PubChem (NCBI)