CAS 89523-51-3 appears in our catalog under these names: 5-Bromobenzo[c]phenanthrene, 95%, 5-Bromobenzo[c]phenanthrene 95%, 5-Bromobenzo[c]phenanthrene, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-bromobenzo[c]phenanthrene (CAS 89523-51-3) is a chemical compound with the molecular formula C18H11Br and a molecular weight of 307.2 g/mol. IUPAC name: 5-bromobenzo[c]phenanthrene. InChIKey: WWCQJSKCEVYQID-UHFFFAOYSA-N.
| Molecular formula | C18H11Br |
|---|---|
| Molecular weight | 307.2 g/mol |
| IUPAC name | 5-bromobenzo[c]phenanthrene |
| InChIKey | WWCQJSKCEVYQID-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=CC=CC=C4C(=C3)Br |
Computed by PubChem (NCBI)