CAS 328016-11-1 is the registry number for 1-(2-chlorobenzyl)-1H-benzimidazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
1-[(2-chlorophenyl)methyl]benzimidazole (CAS 328016-11-1) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 1-[(2-chlorophenyl)methyl]benzimidazole. InChIKey: ZMXLDEADNMFYNI-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 1-[(2-chlorophenyl)methyl]benzimidazole |
| InChIKey | ZMXLDEADNMFYNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=NC3=CC=CC=C32)Cl |
Computed by PubChem (NCBI)