CAS 3282-99-3 appears in our catalog under these names: 1,1-Bis(4-aminophenyl)cyclohexane, >95% (HPLC), 1,1-Bis(4-aminophenyl)cyclohexane, >98.0%(GC), 1,1-Bis(4-aminophenyl)cyclohexane 98%, Benzenamine, 4,4'-cyclohexylidenebis-, 98%, 98%, 4,4'-(Cyclohexane-1,1-diyl)dianiline, 98%. Offered by: TRC, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g, 500g, 100g, 50g.
4-[1-(4-aminophenyl)cyclohexyl]aniline (CAS 3282-99-3) is a chemical compound with the molecular formula C18H22N2 and a molecular weight of 266.4 g/mol. IUPAC name: 4-[1-(4-aminophenyl)cyclohexyl]aniline. InChIKey: ZSQIQUAKDNTQOI-UHFFFAOYSA-N.
| Molecular formula | C18H22N2 |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | 4-[1-(4-aminophenyl)cyclohexyl]aniline |
| InChIKey | ZSQIQUAKDNTQOI-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)