Products 328562-81-8
CAS 328562-81-8 is the registry number for 2-(1H-1,2,4-Triazole-3-amido)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(1H-1,2,4-triazole-5-carbonylamino)benzoic acid (CAS 328562-81-8) is a chemical compound with the molecular formula C10H8N4O3 and a molecular weight of 232.20 g/mol. IUPAC name: 2-(1H-1,2,4-triazole-5-carbonylamino)benzoic acid. InChIKey: PBDYQKKVHJDQLD-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O3 |
|---|---|
| Molecular weight | 232.20 g/mol |
| IUPAC name | 2-(1H-1,2,4-triazole-5-carbonylamino)benzoic acid |
| InChIKey | PBDYQKKVHJDQLD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC(=O)C2=NC=NN2 |
Computed by PubChem (NCBI)
Synonyms:
2-(1H-1,2,4-triazole-3-amido)benzoic acid, 2-[(1H-[1,2,4]Triazole-3-carbonyl)-amino]-benzoic acid, 2-(1H-1,2,4-triazole-5-carbonylamino)benzoic acid, CBKinase1_000852, CBKinase1_013252, Cambridge id 5731094, Oprea1_108701, Oprea1_212158, cid_741085, 2-(1H-1,2,4-Triazole-3-carboxamido)benzoicacid