CAS 54553-86-5 appears in our catalog under these names: 2-[(1H-1,2,4-Triazol-5-ylamino)carbonyl]benzoic acid, 95%, 2-((1H-1,2,4-Triazol-5-yl)carbamoyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(1H-1,2,4-triazol-5-ylcarbamoyl)benzoic acid (CAS 54553-86-5) is a chemical compound with the molecular formula C10H8N4O3 and a molecular weight of 232.20 g/mol. IUPAC name: 2-(1H-1,2,4-triazol-5-ylcarbamoyl)benzoic acid. InChIKey: HPIVPOVZQGVUOE-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O3 |
|---|---|
| Molecular weight | 232.20 g/mol |
| IUPAC name | 2-(1H-1,2,4-triazol-5-ylcarbamoyl)benzoic acid |
| InChIKey | HPIVPOVZQGVUOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=NC=NN2)C(=O)O |
Computed by PubChem (NCBI)