CAS 32863-55-1 is the registry number for 4-Methyl-1-propylquinolinium iodide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-methyl-1-propylquinolin-1-ium iodide (CAS 32863-55-1) is a chemical compound with the molecular formula C13H16IN and a molecular weight of 313.18 g/mol. IUPAC name: 4-methyl-1-propylquinolin-1-ium iodide. InChIKey: ZMIVZHDLXLEFSE-UHFFFAOYSA-M.
| Molecular formula | C13H16IN |
|---|---|
| Molecular weight | 313.18 g/mol |
| IUPAC name | 4-methyl-1-propylquinolin-1-ium iodide |
| InChIKey | ZMIVZHDLXLEFSE-UHFFFAOYSA-M |
| SMILES | CCC[N+]1=CC=C(C2=CC=CC=C21)C.[I-] |
Computed by PubChem (NCBI)