CAS 55602-26-1 is the registry number for Quinolinium, 2-methyl-1-propyl-, iodide, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-methyl-1-propylquinolin-1-ium iodide (CAS 55602-26-1) is a chemical compound with the molecular formula C13H16IN and a molecular weight of 313.18 g/mol. IUPAC name: 2-methyl-1-propylquinolin-1-ium iodide. InChIKey: SMBUDSPMXODKAL-UHFFFAOYSA-M.
| Molecular formula | C13H16IN |
|---|---|
| Molecular weight | 313.18 g/mol |
| IUPAC name | 2-methyl-1-propylquinolin-1-ium iodide |
| InChIKey | SMBUDSPMXODKAL-UHFFFAOYSA-M |
| SMILES | CCC[N+]1=C(C=CC2=CC=CC=C21)C.[I-] |
Computed by PubChem (NCBI)