CAS 329202-21-3 appears in our catalog under these names: 3-Chloro-5-(2-(trimethylsilyl)ethynyl)pyridine, 3-Chloro-5-(2-(trimethylsilyl)ethynyl)pyridine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 10g.
2-(5-chloro-3-pyridinyl)ethynyl-trimethylsilane (CAS 329202-21-3) is a chemical compound with the molecular formula C10H12ClNSi and a molecular weight of 209.75 g/mol. IUPAC name: 2-(5-chloro-3-pyridinyl)ethynyl-trimethylsilane. InChIKey: NAMUZWXILOMIGX-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNSi |
|---|---|
| Molecular weight | 209.75 g/mol |
| IUPAC name | 2-(5-chloro-3-pyridinyl)ethynyl-trimethylsilane |
| InChIKey | NAMUZWXILOMIGX-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=CC(=CN=C1)Cl |
Computed by PubChem (NCBI)