CAS 499193-57-6 is the registry number for 2-Chloro-4-(2-(trimethylsilyl)ethynyl)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-(2-chloro-4-pyridinyl)ethynyl-trimethylsilane (CAS 499193-57-6) is a chemical compound with the molecular formula C10H12ClNSi and a molecular weight of 209.75 g/mol. IUPAC name: 2-(2-chloro-4-pyridinyl)ethynyl-trimethylsilane. InChIKey: GUFPUCBBPLNIIN-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNSi |
|---|---|
| Molecular weight | 209.75 g/mol |
| IUPAC name | 2-(2-chloro-4-pyridinyl)ethynyl-trimethylsilane |
| InChIKey | GUFPUCBBPLNIIN-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=CC(=NC=C1)Cl |
Computed by PubChem (NCBI)