Products 3293-89-8
CAS 3293-89-8 appears in our catalog under these names: Dimethyl 2,5-dichloroterephthalate, 95%, Dimethyl 2，5–dichloroterephthalate, Dimethyl 2,5-dichloroterephthalate 95+%, Dimethyl 2,5-dichloroterephthalate, 95+%, 95+%, Dimethyl 2,5-dichloroterephthalate, 95+%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
Dimethyl 2,5-dichlorobenzene-1,4-dicarboxylate (CAS 3293-89-8) is a chemical compound with the molecular formula C10H8Cl2O4 and a molecular weight of 263.07 g/mol. IUPAC name: dimethyl 2,5-dichlorobenzene-1,4-dicarboxylate. InChIKey: RDDWGNUSHLFXED-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O4 |
|---|---|
| Molecular weight | 263.07 g/mol |
| IUPAC name | dimethyl 2,5-dichlorobenzene-1,4-dicarboxylate |
| InChIKey | RDDWGNUSHLFXED-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Cl)C(=O)OC)Cl |
Computed by PubChem (NCBI)
Synonyms:
Dimethyl 2,5-dichloroterephthalate, 1,4-Dimethyl 2,5-dichloro-1,4-benzenedicarboxylate, InChI=1/C10H8Cl2O4/c1-15-9(13)5-3-8(12)6(4-7(5)11)10(14)16-2/h3-4H,1-2H, dimethyl 2,5-dichlorobenzene-1,4-dicarboxylate, 1,4-Benzenedicarboxylic acid, 2,5-dichloro-, 1,4-dimethyl ester, 2,5-Dichloroterephthalic acid dimethyl ester, CBDivE_013539, IFLab1_000211, Dimethyl2,5-dichloroterephthalate, 1,4-Benzenedicarboxylic acid, 2,5-dichloro-, dimethyl ester