CAS 812642-69-6 is the registry number for 2-(2,6-Dichloro-4-formylphenoxy)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(2,6-dichloro-4-formylphenoxy)propanoic acid (CAS 812642-69-6) is a chemical compound with the molecular formula C10H8Cl2O4 and a molecular weight of 263.07 g/mol. IUPAC name: 2-(2,6-dichloro-4-formylphenoxy)propanoic acid. InChIKey: OHRIXVQLDRUTQY-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O4 |
|---|---|
| Molecular weight | 263.07 g/mol |
| IUPAC name | 2-(2,6-dichloro-4-formylphenoxy)propanoic acid |
| InChIKey | OHRIXVQLDRUTQY-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=C(C=C(C=C1Cl)C=O)Cl |
Computed by PubChem (NCBI)