Products 812642-69-6

CAS 812642-69-6 is the registry number for 2-(2,6-Dichloro-4-formylphenoxy)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-(2,6-dichloro-4-formylphenoxy)propanoic acid (CAS 812642-69-6) is a chemical compound with the molecular formula C10H8Cl2O4 and a molecular weight of 263.07 g/mol. IUPAC name: 2-(2,6-dichloro-4-formylphenoxy)propanoic acid. InChIKey: OHRIXVQLDRUTQY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8Cl2O4
Molecular weight263.07 g/mol
IUPAC name2-(2,6-dichloro-4-formylphenoxy)propanoic acid
InChIKeyOHRIXVQLDRUTQY-UHFFFAOYSA-N
SMILESCC(C(=O)O)OC1=C(C=C(C=C1Cl)C=O)Cl

Computed by PubChem (NCBI)