CAS 329976-73-0 appears in our catalog under these names: Potassium benzyltrifluoroborate, 97%, Potassium benzyltrifluoroborate, Potassium benzyltrifluoroborate 97%, Borate(1-), trifluoro(phenylmethyl)-, potassium, (T-4)-, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 100g, 250mg.
Potassium benzyl(trifluoro)boranuide (CAS 329976-73-0) is a chemical compound with the molecular formula C7H7BF3K and a molecular weight of 198.04 g/mol. IUPAC name: potassium benzyl(trifluoro)boranuide. InChIKey: WGHDAVWURFVTQC-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3K |
|---|---|
| Molecular weight | 198.04 g/mol |
| IUPAC name | potassium benzyl(trifluoro)boranuide |
| InChIKey | WGHDAVWURFVTQC-UHFFFAOYSA-N |
| SMILES | [B-](CC1=CC=CC=C1)(F)(F)F.[K+] |
Computed by PubChem (NCBI)