CAS 850623-42-6 appears in our catalog under these names: Potassium (3-methylphenyl)trifluoroborate, 96%, Potassium trifluoro(m-tolyl)borate 98%, Potassium trifluoro(m-tolyl)borate, 98%, 98%, Potassium trifluoro(m-tolyl)borate, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g.
Potassium trifluoro-(3-methylphenyl)boranuide (CAS 850623-42-6) is a chemical compound with the molecular formula C7H7BF3K and a molecular weight of 198.04 g/mol. IUPAC name: potassium trifluoro-(3-methylphenyl)boranuide. InChIKey: FRGRQMARQLLUEM-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3K |
|---|---|
| Molecular weight | 198.04 g/mol |
| IUPAC name | potassium trifluoro-(3-methylphenyl)boranuide |
| InChIKey | FRGRQMARQLLUEM-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC(=CC=C1)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)