CAS 33006-91-6 appears in our catalog under these names: 4-(5-Chloro-2-pyridylazo)-1,3-phenylenediamine [for Colorimetric Analysis of Co, Cd], >99.0%(HPLC)(T), 4-[2-(5-Chloro-2-pyridinyl)diazenyl]-1,3-benzenediamine, 99%, 99%. Offered by: TCI, Chemat. Available pack sizes: 100mg, 1g, 25mg, 250mg.
4-[(5-chloro-2-pyridinyl)diazenyl]benzene-1,3-diamine (CAS 33006-91-6) is a chemical compound with the molecular formula C11H10ClN5 and a molecular weight of 247.68 g/mol. IUPAC name: 4-[(5-chloro-2-pyridinyl)diazenyl]benzene-1,3-diamine. InChIKey: WLNTVTDTBKPTCA-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN5 |
|---|---|
| Molecular weight | 247.68 g/mol |
| IUPAC name | 4-[(5-chloro-2-pyridinyl)diazenyl]benzene-1,3-diamine |
| InChIKey | WLNTVTDTBKPTCA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)N)N=NC2=NC=C(C=C2)Cl |
Computed by PubChem (NCBI)