CAS 83-17-0 is the registry number for 4-Benzylideneaminoantipyrine. Offered by: Mikromol. Available pack sizes: 25mg.
4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one (CAS 83-17-0) is a chemical compound with the molecular formula C18H17N3O and a molecular weight of 291.3 g/mol. IUPAC name: 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one. InChIKey: DOFPFUSLGOLLCL-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one |
| InChIKey | DOFPFUSLGOLLCL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N=CC3=CC=CC=C3 |
Computed by PubChem (NCBI)