CAS 33100-15-1 appears in our catalog under these names: 2-(2-Nitrophenyl)ethanamine, 97%, Mirabegron Impurity 24. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 25g, 5g, 250mg, on request.
2-(2-nitrophenyl)ethanamine (CAS 33100-15-1) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2-(2-nitrophenyl)ethanamine. InChIKey: UIYSCXBCJJMZQR-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2-(2-nitrophenyl)ethanamine |
| InChIKey | UIYSCXBCJJMZQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCN)[N+](=O)[O-] |
Computed by PubChem (NCBI)