CAS 331269-87-5 appears in our catalog under these names: 2-(4-Bromophenyl)-2-oxoethyl 4-aminobenzoate, 95%, 2-(4-Bromophenyl)-2-oxoethyl 4-aminobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
[2-(4-bromophenyl)-2-oxoethyl] 4-aminobenzoate (CAS 331269-87-5) is a chemical compound with the molecular formula C15H12BrNO3 and a molecular weight of 334.16 g/mol. IUPAC name: [2-(4-bromophenyl)-2-oxoethyl] 4-aminobenzoate. InChIKey: PSNLDGFHMAKHOZ-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO3 |
|---|---|
| Molecular weight | 334.16 g/mol |
| IUPAC name | [2-(4-bromophenyl)-2-oxoethyl] 4-aminobenzoate |
| InChIKey | PSNLDGFHMAKHOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OCC(=O)C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)