CAS 84023-60-9 is the registry number for Ketorolac Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
5-benzoyl-7-bromo-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid (CAS 84023-60-9) is a chemical compound with the molecular formula C15H12BrNO3 and a molecular weight of 334.16 g/mol. IUPAC name: 5-benzoyl-7-bromo-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid. InChIKey: QUGMOATWHYRJFE-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO3 |
|---|---|
| Molecular weight | 334.16 g/mol |
| IUPAC name | 5-benzoyl-7-bromo-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid |
| InChIKey | QUGMOATWHYRJFE-UHFFFAOYSA-N |
| SMILES | C1CN2C(=CC(=C2C1C(=O)O)Br)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)