Products 84023-60-9

CAS 84023-60-9 is the registry number for Ketorolac Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-benzoyl-7-bromo-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid (CAS 84023-60-9) is a chemical compound with the molecular formula C15H12BrNO3 and a molecular weight of 334.16 g/mol. IUPAC name: 5-benzoyl-7-bromo-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid. InChIKey: QUGMOATWHYRJFE-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12BrNO3
Molecular weight334.16 g/mol
IUPAC name5-benzoyl-7-bromo-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid
InChIKeyQUGMOATWHYRJFE-UHFFFAOYSA-N
SMILESC1CN2C(=CC(=C2C1C(=O)O)Br)C(=O)C3=CC=CC=C3

Computed by PubChem (NCBI)